Catalog No. | Product Name | Summary | Targets | CAS Number | Smiles |
A2576 | E-64 | Cysteine protease inhibitor,irriversible | Cathepsin | 66701-25-5 | CC(C)CC(C(=O)NCCCCN=C(N)N)NC(=O)C1C(O1)C(=O)O |
A2606 | Epoxomicin | Proteasome inhibitor | Proteasome | 134381-21-8 | CCC(C)C(C(=O)NC(C(C)O)C(=O)NC(CC(C)C)C(=O)C1(CO1)C)NC(=O)C(C(C)CC)N(C)C(=O)C |
A4018 | YO-01027 (Dibenzazepine, DBZ) | γ-secretase inhibitor | Gamma Secretase | 209984-56-5 | CC(C(=O)NC1C2=CC=CC=C2C3=CC=CC=C3N(C1=O)C)NC(=O)CC4=CC(=CC(=C4)F)F |
A4054 | 17-AAG (KOS953) | Hsp90 inhibitor | HSP | 75747-14-7 | CC1CC(C(C(C=C(C(C(C=CC=C(C(=O)NC2=CC(=O)C(=C(C1)C2=O)NCC=C)C)OC)OC(=O)N)C)C)O)OC |
A8200 | DAPT (GSI-IX) | γ-secretase inhibitor,potent and specific | Amyloid β | 208255-80-5 | CC(C(=O)NC(C1=CC=CC=C1)C(=O)OC(C)(C)C)NC(=O)CC2=CC(=CC(=C2)F)F |
A8203 | Ritonavir | HIV protease inhibitor | HIV Protease | 155213-67-5 | CC(C)C1=NC(=CS1)CN(C)C(=O)NC(C(C)C)C(=O)NC(CC2=CC=CC=C2)CC(C(CC3=CC=CC=C3)NC(=O)OCC4=CN=CS4)O |
A8206 | Darunavir | HIV-1 protease inhibitor | HIV Protease | 635728-49-3 | CCO.CC(C)CN(CC(C(CC1=CC=CC=C1)NC(=O)OC2COC3C2CCO3)O)S(=O)(=O)C4=CC=C(C=C4)N |
A8239 | CA-074 Me | Cathepsin B inhibitor | Cathepsin | 147859-80-1 | CCCNC(=O)C1C(O1)C(=O)NC(C(C)CC)C(=O)N2CCCC2C(=O)OC |
Download the Protease-Inhibitor-Library - XLSX Download the Protease-Inhibitor-Library - SDF |