Catalog No. | Product Name | Summary | Targets | CAS Number | Smiles |
A1933 | Carfilzomib (PR-171) | Proteasome inhibitor,epoxomicin analog | Proteasome | 868540-17-4 | CC(C)CC(C(=O)C1(CO1)C)NC(=O)C(CC2=CC=CC=C2)NC(=O)C(CC(C)C)NC(=O)C(CCC3=CC=CC=C3)NC(=O)CN4CCOCC4 |
A4084 | Vorinostat (SAHA, MK0683) | HDAC inhibitor | HDAC | 149647-78-9 | C1=CC=C(C=C1)NC(=O)CCCCCCC(=O)NO |
A4105 | M344 | HDAC inhibitor,potent and cell-permeable | HDAC | 251456-60-7 | CN(C)C1=CC=C(C=C1)C(=O)NCCCCCCC(=O)NO |
A4120 | MK-5108 (VX-689) | Aurora-A kinase inhibitor,highly selective | Aurora Kinase | 1010085-13-8 | C1CC(CCC1OC2=C(C(=CC=C2)Cl)F)(CC3=NC(=CC=C3)NC4=NC=CS4)C(=O)O |
A4192 | SGI-1776 free base | Pim kinase inhibitor,ATP-competitive | Pim | 1025065-69-3 | CN1CCC(CC1)CNC2=NN3C(=NC=C3C4=CC(=CC=C4)OC(F)(F)F)C=C2 |
A8193 | ABT-737 | Bcl-2 inhibitor | Bcl-2 Family | 852808-04-9 | CN(C)CCC(CSC1=CC=CC=C1)NC2=C(C=C(C=C2)S(=O)(=O)NC(=O)C3=CC=C(C=C3)N4CCN(CC4)CC5=CC=CC=C5C6=CC=C(C=C6)Cl)[N+](=O)[O-] |
A8715 | SBI-0206965 | ULK1 inhibitor | Autophagy | 1538604-68-0 | BrC1=C(OC2=C(C(NC)=O)C=CC=C2)N=C(NC3=CC(OC)=C(OC)C(OC)=C3)N=C1 |
A8883 | SAR405 | Selective ATP-competitive inhibitor of Vps34 | Autophagy | 1523406-39-4 | C[C@H]1N(C(N=C2N3CC[C@@H](C(F)(F)F)N2CC4=CN=CC(Cl)=C4)=CC3=O)CCOC1 |
Download the Autophagy-Compound-Library - XLSX Download the Autophagy-Compound-Library - SDF |